For research use only. Not for therapeutic Use.
PF9601N（Cat No.:I012300）is a selective inhibitor of the protein kinase C (PKC) family, specifically targeting the PKC-α isoform. PKC plays a critical role in regulating cellular processes such as growth, differentiation, and apoptosis. By inhibiting PKC-α, PF9601N disrupts signaling pathways involved in cancer progression, inflammation, and other diseases. This compound has shown promise in preclinical studies for its potential to treat cancers, including breast and prostate cancers, where PKC-α is often overactive. PF9601N is a valuable tool for exploring PKC-targeted therapies and advancing cancer research.
| CAS Number | 133845-63-3 |
| Synonyms | N-[(5-phenylmethoxy-1H-indol-2-yl)methyl]prop-2-yn-1-amine |
| Molecular Formula | C19H18N2O |
| Purity | ≥95% |
| IUPAC Name | N-[(5-phenylmethoxy-1H-indol-2-yl)methyl]prop-2-yn-1-amine |
| InChI | InChI=1S/C19H18N2O/c1-2-10-20-13-17-11-16-12-18(8-9-19(16)21-17)22-14-15-6-4-3-5-7-15/h1,3-9,11-12,20-21H,10,13-14H2 |
| InChIKey | YFPNAYXYKXAKJC-UHFFFAOYSA-N |
| SMILES | C#CCNCC1=CC2=C(N1)C=CC(=C2)OCC3=CC=CC=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
