For research use only. Not for therapeutic Use.
PF-4618433（Cat No.:I015027）is a potent, selective inhibitor of p38α mitogen-activated protein kinase (MAPK), a key enzyme involved in inflammatory and stress-response signaling. By blocking p38α activity, PF-4618433 suppresses the production of pro-inflammatory cytokines such as TNF-α and IL-1β, making it valuable in studying inflammation-driven diseases. Preclinical studies indicate potential applications in autoimmune disorders, rheumatoid arthritis, and other chronic inflammatory conditions. Its strong selectivity profile allows precise dissection of p38α-dependent pathways without significant off-target effects. PF-4618433 serves as both a pharmacological tool and therapeutic research candidate.
| CAS Number | 1166393-85-6 |
| Synonyms | 1-[5-tert-butyl-2-(4-methylphenyl)pyrazol-3-yl]-3-[5-(pyridin-3-yloxymethyl)-1H-pyrazol-3-yl]urea |
| Molecular Formula | C24H27N7O2 |
| Purity | ≥95% |
| IUPAC Name | 1-[5-tert-butyl-2-(4-methylphenyl)pyrazol-3-yl]-3-[5-(pyridin-3-yloxymethyl)-1H-pyrazol-3-yl]urea |
| InChI | InChI=1S/C24H27N7O2/c1-16-7-9-18(10-8-16)31-22(13-20(30-31)24(2,3)4)27-23(32)26-21-12-17(28-29-21)15-33-19-6-5-11-25-14-19/h5-14H,15H2,1-4H3,(H3,26,27,28,29,32) |
| InChIKey | NJARPUHZDSAXPL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C(=CC(=N2)C(C)(C)C)NC(=O)NC3=NNC(=C3)COC4=CN=CC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
