For research use only. Not for therapeutic Use.
PF-06761281（Cat No.:I034498）is a selective peptide inhibitor targeting the protein TYK2, a Janus kinase involved in the signaling of various cytokines related to immune responses. By inhibiting TYK2, PF-06761281 helps to modulate inflammation and immune system activation, making it a promising candidate for research in autoimmune diseases, inflammatory disorders, and certain cancers. Its high specificity and potency allow for targeted exploration of TYK2-mediated pathways. This peptide inhibitor is an essential tool for understanding immune regulation and developing potential therapies for immune-related diseases.
| CAS Number | 1854061-19-0 |
| Synonyms | (2R)-2-hydroxy-2-[2-(2-methoxy-5-methylpyridin-3-yl)ethyl]butanedioic acid |
| Molecular Formula | C13H17NO6 |
| Purity | ≥95% |
| IUPAC Name | (2R)-2-[2-(4-tert-butylphenyl)ethyl]-2-hydroxybutanedioic acid |
| InChI | InChI=1S/C16H22O5/c1-15(2,3)12-6-4-11(5-7-12)8-9-16(21,14(19)20)10-13(17)18/h4-7,21H,8-10H2,1-3H3,(H,17,18)(H,19,20)/t16-/m1/s1 |
| InChIKey | QNFWRHKLBLSSPB-MRXNPFEDSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)CC[C@@](CC(=O)O)(C(=O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
