For research use only. Not for therapeutic Use.
PF-06685249（Cat No.:I034515）is a selective peptide inhibitor targeting the CXCR4 receptor, a key player in immune cell trafficking and cancer metastasis. By blocking CXCR4 signaling, PF-06685249 disrupts tumor growth and immune evasion, making it a promising candidate for cancer research and immunotherapy. It is particularly effective in studying hematologic malignancies and solid tumors. This high-purity inhibitor allows researchers to investigate the therapeutic potential of CXCR4 modulation in oncology and inflammatory diseases. PF-06685249 is a valuable tool for advancing understanding of disease mechanisms and developing targeted treatments.
| CAS Number | 1467059-70-6 |
| Synonyms | 6-chloro-5-[6-(dimethylamino)-2-methoxypyridin-3-yl]-1H-indole-3-carboxylic acid |
| Molecular Formula | C17H16ClN3O3 |
| Purity | ≥95% |
| IUPAC Name | 6-chloro-5-[6-(dimethylamino)-2-methoxypyridin-3-yl]-1H-indole-3-carboxylic acid |
| InChI | InChI=1S/C17H16ClN3O3/c1-21(2)15-5-4-9(16(20-15)24-3)10-6-11-12(17(22)23)8-19-14(11)7-13(10)18/h4-8,19H,1-3H3,(H,22,23) |
| InChIKey | MJHBRTGGZYSCHJ-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC(=C(C=C1)C2=C(C=C3C(=C2)C(=CN3)C(=O)O)Cl)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
