For research use only. Not for therapeutic Use.
PF-04753299（Cat No.:I014799）is a potent and selective inhibitor of diacylglycerol acyltransferase 1 (DGAT1), an enzyme critical for triglyceride synthesis and lipid metabolism. By blocking DGAT1 activity, PF-04753299 reduces triglyceride accumulation and modulates energy balance, making it a valuable tool for studying obesity, diabetes, and metabolic syndrome. Researchers use PF-04753299 to explore therapeutic strategies targeting lipid regulation, insulin sensitivity, and related metabolic pathways. Its defined activity and selectivity support preclinical investigations into lipid biology and the development of novel treatments for metabolic and cardiovascular diseases.
| CAS Number | 1289620-49-0 |
| Synonyms | (2R)-N-hydroxy-2-methyl-2-methylsulfonyl-4-(4-phenylphenyl)butanamide |
| Molecular Formula | C18H21NO4S |
| Purity | ≥95% |
| IUPAC Name | (2R)-N-hydroxy-2-methyl-2-methylsulfonyl-4-(4-phenylphenyl)butanamide |
| InChI | InChI=1S/C18H21NO4S/c1-18(17(20)19-21,24(2,22)23)13-12-14-8-10-16(11-9-14)15-6-4-3-5-7-15/h3-11,21H,12-13H2,1-2H3,(H,19,20)/t18-/m1/s1 |
| InChIKey | GDYIQUFNICPYHF-GOSISDBHSA-N |
| SMILES | C[C@@](CCC1=CC=C(C=C1)C2=CC=CC=C2)(C(=O)NO)S(=O)(=O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
