For research use only. Not for therapeutic Use.
PF-04449613（Cat No.:I011334）is a potent and selective small-molecule inhibitor of Smoothened (SMO), a key transmembrane protein in the Hedgehog (Hh) signaling pathway. Developed by Pfizer, it targets aberrant Hh pathway activation implicated in various cancers, including basal cell carcinoma and medulloblastoma. By inhibiting SMO, PF-04449613 disrupts downstream signaling crucial for tumor growth and survival. It serves as a valuable research tool for studying developmental biology, cancer progression, and drug resistance mechanisms. Its specificity makes it suitable for preclinical models exploring targeted cancer therapies involving Hedgehog pathway modulation.
| CAS Number | 1236858-52-8 |
| Synonyms | 1-(oxan-4-yl)-6-[(1R)-1-(3-phenoxyazetidin-1-yl)ethyl]-5H-pyrazolo[3,4-d]pyrimidin-4-one |
| Molecular Formula | C21H25N5O3 |
| Purity | ≥95% |
| IUPAC Name | 1-(oxan-4-yl)-6-[(1R)-1-(3-phenoxyazetidin-1-yl)ethyl]-5H-pyrazolo[3,4-d]pyrimidin-4-one |
| InChI | InChI=1S/C21H25N5O3/c1-14(25-12-17(13-25)29-16-5-3-2-4-6-16)19-23-20-18(21(27)24-19)11-22-26(20)15-7-9-28-10-8-15/h2-6,11,14-15,17H,7-10,12-13H2,1H3,(H,23,24,27)/t14-/m1/s1 |
| InChIKey | FHBANDDJQJAZOQ-CQSZACIVSA-N |
| SMILES | C[C@H](C1=NC2=C(C=NN2C3CCOCC3)C(=O)N1)N4CC(C4)OC5=CC=CC=C5 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
