For research use only. Not for therapeutic Use.
Perseitol(Cat No.:I043805)is a naturally occurring polyol, often found in certain plant species. This carbohydrate derivative exhibits unique properties, such as high solubility and stability, making it useful in various industrial applications. It has potential as a stabilizer in food and cosmetic formulations due to its ability to retain moisture and enhance product texture. Additionally, perseitol’s non-toxic and biocompatible nature makes it an appealing candidate for pharmaceutical research, particularly in drug delivery systems. Its versatility in formulations highlights its importance across multiple sectors, including cosmetics and pharmaceuticals.
| CAS Number | 527-06-0 |
| Synonyms | heptane-1,2,3,4,5,6,7-heptol |
| Molecular Formula | C7H16O7 |
| Purity | ≥95% |
| IUPAC Name | (2S,3R,5R,6R)-heptane-1,2,3,4,5,6,7-heptol |
| InChI | InChI=1S/C7H16O7/c8-1-3(10)5(12)7(14)6(13)4(11)2-9/h3-14H,1-2H2/t3-,4+,5-,6-,7?/m1/s1 |
| InChIKey | OXQKEKGBFMQTML-RYRJNEICSA-N |
| SMILES | C([C@H]([C@H](C([C@@H]([C@H](CO)O)O)O)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |