For research use only. Not for therapeutic Use.
Peropyrene (Cat No.: M068180) is a polycyclic aromatic hydrocarbon (PAH) consisting of a fused framework of multiple benzene rings, extending the conjugation of pyrene. This planar, π-rich molecule exhibits strong fluorescence and high thermal stability, making it valuable in organic electronics, especially in organic semiconductors, OLEDs, and photovoltaic materials. Its extended π-system facilitates efficient charge transport and light absorption. Peropyrene is also studied for its photophysical properties and potential use in molecular sensors, supramolecular chemistry, and as a building block in nanostructured carbon materials.
| CAS Number | 188-96-5 |
| Molecular Formula | C26H14 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | heptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1,3(12),4,6,8,10,13(23),14,16,18,20(24),21,25-tridecaene |
| InChI | InChI=1S/C26H14/c1-3-15-7-11-19-21-13-9-17-5-2-6-18-10-14-22(26(21)24(17)18)20-12-8-16(4-1)23(15)25(19)20/h1-14H |
| InChIKey | WCXXBFNWCCIYQO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C=CC4=C3C(=C5C=CC6=C7C5=C4C=CC7=CC=C6)C=C2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
