For research use only. Not for therapeutic Use.
PERK-IN-6（Cat No.:I041304）is a selective inhibitor targeting the Protein Kinase RNA-like Endoplasmic Reticulum Kinase (PERK), an important regulator of the unfolded protein response (UPR) in cells. By inhibiting PERK, PERK-IN-6 aims to disrupt the adaptive response to cellular stress, which is often upregulated in cancer cells and other diseases like neurodegeneration. This inhibition can lead to reduced tumor growth and enhanced sensitivity to chemotherapy. Preclinical studies have suggested that PERK-IN-6 could provide a therapeutic advantage in treating cancers and neurological disorders characterized by ER stress and UPR dysregulation.
| CAS Number | 1337532-14-5 |
| Synonyms | 1-[5-(4-amino-7-methylpyrrolo[2,3-d]pyrimidin-5-yl)-2,3-dihydroindol-1-yl]-2-(6-methylpyridin-2-yl)ethanone |
| Molecular Formula | C23H22N6O |
| Purity | ≥95% |
| IUPAC Name | 1-[5-(4-amino-7-methylpyrrolo[2,3-d]pyrimidin-5-yl)-2,3-dihydroindol-1-yl]-2-(6-methylpyridin-2-yl)ethanone |
| InChI | InChI=1S/C23H22N6O/c1-14-4-3-5-17(27-14)11-20(30)29-9-8-16-10-15(6-7-19(16)29)18-12-28(2)23-21(18)22(24)25-13-26-23/h3-7,10,12-13H,8-9,11H2,1-2H3,(H2,24,25,26) |
| InChIKey | VYZYOJULVVGQRS-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC=C1)CC(=O)N2CCC3=C2C=CC(=C3)C4=CN(C5=NC=NC(=C45)N)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
