Perfluorooctanoic Acid (PFOA), also known as C8, is a synthetic chemical primarily used as a surfactant in the manufacture of various products, including non-stick cookware, stain-resistant fabrics, and fire-fighting foams. PFOA is highly persistent in the environment and has been associated with numerous health risks, such as cancer, liver damage, and developmental issues. Due to its environmental persistence and potential health effects, its use and disposal are subject to stringent regulatory controls in many countries.
| Catalog Number | R057755 |
| CAS Number | 335-67-1 |
| Synonyms | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-Pentadecafluorooctanoic Acid; Pentadecafluorooctanoic Acid; A 5717; EF 201; Eftop EF 201; NSC 95114; Pentadecafluoro-n-octanoic Acid; Pentadecafluorooctanoic Acid; Perfluoro-1-heptanecarboxylic Acid; Perfluorocaprylic Ac |
| Molecular Formula | C8HF15O2 |
| Purity | ≥95% |
| Storage | Store at +4 ℃ |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoic acid |
| InChI | InChI=1S/C8HF15O2/c9-2(10,1(24)25)3(11,12)4(13,14)5(15,16)6(17,18)7(19,20)8(21,22)23/h(H,24,25) |
| InChIKey | SNGREZUHAYWORS-UHFFFAOYSA-N |
| SMILES | C(=O)(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O |
