For research use only. Not for therapeutic Use.
Perfluorooctanesulfonamide (CAT: R032765) is a synthetic fluorinated compound widely used as an intermediate in the production of perfluorinated surfactants and materials such as stain repellents, firefighting foams, and water-resistant coatings. Its high thermal and chemical stability make it ideal for industrial applications. However, PFOSA is also of environmental concern due to its persistence and potential bioaccumulation. In research, PFOSA is often studied for its role in perfluorinated compound metabolism, toxicology, and environmental distribution. It is a valuable tool for scientists investigating perfluoroalkyl substances (PFAS) exposure and effects in biological and ecological systems.
| CAS Number | 754-91-6 |
| Synonyms | AI 3-29759; Desethylsulfluramid; Perfluoroctylsulfonamide;?Perfluorooctanesulfonamide; Perfluorooctanesulfonic Acid Amide?Perfluorooctylsulfonamide; |
| Molecular Formula | C8H2F17NO2S |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonamide |
| InChI | InChI=1S/C8H2F17NO2S/c9-1(10,3(13,14)5(17,18)7(21,22)23)2(11,12)4(15,16)6(19,20)8(24,25)29(26,27)28/h(H2,26,27,28) |
| InChIKey | RRRXPPIDPYTNJG-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(F)(F)S(=O)(=O)N)(F)F)(F)F)(F)F)(C(C(C(F)(F)F)(F)F)(F)F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
