As a carboxylic acid derivative, perfluoroheptanoic acid (Cat.No: R059260) is a typical fluorine surfactant with strong hydrophobicity and oleophobicity. It is often used in the chromium plating industry to prevent chromic acid mist from escaping.
Catalog Number | R059260 |
CAS Number | 375-85-9 |
Synonyms | 2,2,3,3,4,4,5,5,6,6,7,7,7-Tridecafluoroheptanoic Acid; Tridecafluoroheptanoic Acid;?Perfluoro-n-heptanoic Acid; Perfluoroenanthic Acid; |
Molecular Formula | C7HF13O2 |
Purity | 95% |
Storage | -20°C |
IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoic acid |
InChI | InChI=1S/C7HF13O2/c8-2(9,1(21)22)3(10,11)4(12,13)5(14,15)6(16,17)7(18,19)20/h(H,21,22) |
InChIKey | ZWBAMYVPMDSJGQ-UHFFFAOYSA-N |
SMILES | C(=O)(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O |