Perfluoro(4-methyl-3,6-dioxaoct-7-ene)sulfonyl fluoride(Cat No.:R032504), is a fluorinated chemical compound known for its unique properties. It is part of the perfluoroalkyl and perfluoroalkyl ether sulfonate class of compounds, which are used in various industrial applications. This compound is often employed as a reactive intermediate in the synthesis of specialty fluorinated materials, such as fluorinated surfactants, polymers, and lubricants.
Catalog Number | R032504 |
CAS Number | 16090-14-5 |
Synonyms | 1,1,2,2-Tetrafluoro-2-[1,2,2-trifluoro-1-(trifluoromethyl)-2-[(trifluorovinyl)oxy]ethoxy]ethanesulfonyl Fluoride; 2-[1-[difluoro[(1,2,2-trifluoroethenyl)oxy]methyl]-1,2,2,2-tetrafluoroethoxy]-1,1,2,2-tetrafluoroethanesulfonyl Fluoride; FS 14; Perflu |
Molecular Formula | C7F14O4S |
Purity | 95% |
Storage | -20°C |
IUPAC Name | 1,1,2,2-tetrafluoro-2-[1,1,1,2,3,3-hexafluoro-3-(1,2,2-trifluoroethenoxy)propan-2-yl]oxyethanesulfonyl fluoride |
InChI | InChI=1S/C7F14O4S/c8-1(9)2(10)24-5(15,16)3(11,4(12,13)14)25-6(17,18)7(19,20)26(21,22)23 |
InChIKey | KTCQQCLZUOZFEI-UHFFFAOYSA-N |
SMILES | C(=C(F)F)(OC(C(C(F)(F)F)(OC(C(F)(F)S(=O)(=O)F)(F)F)F)(F)F)F |
Reference | <span style=”font-size:12px;”>1.Colpaert, Maxime, Vincent Ladmiral, and Bruno Ameduri. "Revisiting the Radical copolymerization of Vinylidene Fluoride with Perfluoro (4-methyl-3, 6-dioxaoct-7-ene) sulfonyl fluoride." <i style=”font-family: Arial, sans-serif; font-size: 13px;”>Hyceltec</i>. 2017.<br /> |