Perfluoro(4-methyl-3,6-dioxaoct-7-ene)sulfonyl Fluoride - CAS 16090-14-5
Perfluoro(4-methyl-3,6-dioxaoct-7-ene)sulfonyl fluoride(Cat No.:R032504), is a fluorinated chemical compound known for its unique properties. It is part of the perfluoroalkyl and perfluoroalkyl ether sulfonate class of compounds, which are used in various industrial applications. This compound is often employed as a reactive intermediate in the synthesis of specialty fluorinated materials, such as fluorinated surfactants, polymers, and lubricants.
Catalog Number: R032504
CAS Number: 16090-14-5
PubChem Substance ID:355194210
Molecular Formula: C7F14O4S
Molecular Weight:446.11
Purity: ≥95%
* For research use only. Not for human or veterinary use.
Synonym
Synonyms | 1,1,2,2-Tetrafluoro-2-[1,2,2-trifluoro-1-(trifluoromethyl)-2-[(trifluorovinyl)oxy]ethoxy]ethanesulfonyl Fluoride; 2-[1-[difluoro[(1,2,2-trifluoroethenyl)oxy]methyl]-1,2,2,2-tetrafluoroethoxy]-1,1,2,2-tetrafluoroethanesulfonyl Fluoride; FS 14; Perflu |
---|
Property
Molecular Formula: | C7F14O4S |
---|---|
Molecular Weight | 446.11 |
Purity | ≥95% |
Storage | -20°C |
Computed Descriptor
IUPAC Name | 1,1,2,2-tetrafluoro-2-[1,1,1,2,3,3-hexafluoro-3-(1,2,2-trifluoroethenoxy)propan-2-yl]oxyethanesulfonyl fluoride |
---|---|
InChI | InChI=1S/C7F14O4S/c8-1(9)2(10)24-5(15,16)3(11,4(12,13)14)25-6(17,18)7(19,20)26(21,22)23 |
InChIKey | KTCQQCLZUOZFEI-UHFFFAOYSA-N |
SMILES | C(=C(F)F)(OC(C(C(F)(F)F)(OC(C(F)(F)S(=O)(=O)F)(F)F)F)(F)F)F |