For research use only. Not for therapeutic Use.
Perflexane(CAT: I014560) is a compound that was specifically developed as an ultrasound (US) contrast agent. Its purpose is to enhance the quality of ultrasound images, particularly in the context of echocardiograms. By introducing Perflexane into the imaging process, the contrast agent helps improve the visibility and resolution of ultrasound images, allowing for better visualization of cardiac structures and enhancing diagnostic accuracy.
| CAS Number | 355-42-0 |
| Synonyms | Perflexane; Fluorinert FC72;;Hexane, tetradecafluoro- |
| Molecular Formula | C6F14 |
| Purity | ≥95% |
| Solubility | Soluble in DMSO |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6,6,6-tetradecafluorohexane |
| InChI | InChI=1S/C6F14/c7-1(8,3(11,12)5(15,16)17)2(9,10)4(13,14)6(18,19)20 |
| InChIKey | ZJIJAJXFLBMLCK-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Reference | <br /> |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |