For research use only. Not for therapeutic Use.
2-Phenoxyethyl acrylate（Cat No.:L015617）is an aromatic acrylate ester featuring a phenoxyethyl moiety linked to an acrylate group. This compound is widely used in the formulation of UV-curable resins, adhesives, and coatings due to its excellent reactivity and ability to form crosslinked polymer networks. The phenyl group contributes to thermal stability and mechanical strength, while the acrylate functionality enables rapid polymerization under UV or electron beam exposure. It is valuable in surface coatings, inks, optical materials, and electronics, offering improved adhesion, flexibility, and resistance to solvents and environmental degradation.
| CAS Number | 48145-04-6 |
| Molecular Formula | C11H12O3 |
| Purity | ≥95% |
| IUPAC Name | 2-phenoxyethyl prop-2-enoate |
| InChI | InChI=1S/C11H12O3/c1-2-11(12)14-9-8-13-10-6-4-3-5-7-10/h2-7H,1,8-9H2 |
| InChIKey | RZVINYQDSSQUKO-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OCCOC1=CC=CC=C1 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
