1. Home
  2. Product
  3. Inhibitors/Agonists
  4. Pentostatin

Pentostatin - CAS 53910-25-1

Pentostatin(CAT: I003974), also known as deoxycoformycin, is a chemotherapy drug used to treat hairy cell leukemia, a rare type of blood cancer. It works by inhibiting the enzyme adenosine deaminase, which is necessary for the growth and survival of cancer cells. Pentostatin is typically administered intravenously and can have significant side effects, including low blood cell counts, nausea, vomiting, and fever. It is considered a relatively effective treatment for hairy cell leukemia, with a high response rate and a potential for durable remission.

Catalog Number: I003974

CAS Number: 53910-25-1

PubChem Substance ID:355040098

Molecular Formula: C11H16N4O4

Molecular Weight:268.3

Purity: ≥95%

Online inquiry

* For research use only. Not for human or veterinary use.

Synonym

Synonyms(8R)-3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-7,8-dihydro-4H-imidazo[4,5-d][1,3]diazepin-8-ol

Property

Molecular Formula: C11H16N4O4
Molecular Weight268.3
Target:Adenosine Receptor
Solubility100 mM in water; 75 mM in DMSO;
Purity≥95%
StorageStore at -20°C
IC502.5 pM

Computed Descriptor

InChIInChI=1S/C11H16N4O4/c16-3-8-6(17)1-9(19-8)15-5-14-10-7(18)2-12-4-13-11(10)15/h4-9,16-18H,1-3H2,(H,12,13)/t6-,7+,8+,9-/m0/s1
InChIKeyFPVKHBSQESCIEP-JQCXWYLXSA-N
SMILESOC[C@@H]1[C@@H](O)C[C@H](N2C=NC3=C2NC=NC[C@H]3O)O1