For research use only. Not for therapeutic Use.
Pelargonidin(CAT: R011666) is a natural anthocyanidin pigment belonging to the flavonoid family, responsible for the bright red to orange coloration in many fruits and flowers such as strawberries, red radishes, and geraniums. It has the molecular formula C₁₅H₁₁O₅⁺ and is typically found as glycosides, such as pelargonidin-3-glucoside, in plants. Pelargonidin exhibits antioxidant, anti-inflammatory, and potential anticancer activities, making it of interest in nutritional, cosmetic, and pharmaceutical research. Its color expression is pH-dependent, appearing red in acidic conditions and shifting toward blue in alkaline environments.
| CAS Number | 134-04-3 |
| Synonyms | 3,5,7-Trihydroxy-2-(4-hydroxyphenyl)-1-benzopyrylium Chloride; 3,4’,5,7-Tetrahydroxyflavylium Chloride; Pelargonidin Chloride; Pelargonidol Chloride; |
| Molecular Formula | C15H11ClO5 |
| Purity | ≥95% |
| Target | NF-κB |
| Storage | -20°C |
| IUPAC Name | 2-(4-hydroxyphenyl)chromenylium-3,5,7-triol;chloride |
| InChI | InChI=1S/C15H10O5.ClH/c16-9-3-1-8(2-4-9)15-13(19)7-11-12(18)5-10(17)6-14(11)20-15;/h1-7H,(H3-,16,17,18,19);1H |
| InChIKey | YPVZJXMTXCOTJN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C=C3C(=CC(=CC3=[O+]2)O)O)O)O.[Cl-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |