For research use only. Not for therapeutic Use.
Pecazine-d3 is a deuterated form of pecazine, a phenothiazine derivative used as an antipsychotic and antiemetic agent. This compound features three deuterium atoms, enhancing its stability and making it particularly valuable for pharmacokinetic studies, drug metabolism research, and isotope-dilution mass spectrometry. Pecazine-d3 is used to investigate the absorption, distribution, metabolism, and excretion (ADME) of pecazine in biological systems. Its isotopic labeling allows for precise tracking in complex biological matrices and serves as a reliable internal standard in analytical chemistry. This ensures accurate and reproducible results in the study of phenothiazine derivatives, particularly in the development and optimization of antipsychotic therapies.
| CAS Number | 60-89-9 |
| Synonyms | 10-[(1-Methyl-3-piperidyl)methyl]phenothiazine-d3; III 2318-d3; Lacumin-d3; MPMP-d3; Mepazin; Mepazine-d3; Mepazine-d3 Base; Meprazine-d3; Mesapin-d3; Nothiazine-d3; P 391-d3; Pacatal-d3; Pacatal Base-d3; Pacatol-d3; Pakatal-d3; Paxital-d3; Pecatal-d |
| Molecular Formula | C₁₉H₁₉D₃N₂S |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 10-[[1-(trideuteriomethyl)piperidin-3-yl]methyl]phenothiazine |
| InChI | InChI=1S/C19H22N2S/c1-20-12-6-7-15(13-20)14-21-16-8-2-4-10-18(16)22-19-11-5-3-9-17(19)21/h2-5,8-11,15H,6-7,12-14H2,1H3/i1D3 |
| InChIKey | CBHCDHNUZWWAPP-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1CCCC(C1)CN2C3=CC=CC=C3SC4=CC=CC=C42 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |