For research use only. Not for therapeutic Use.
PDZ1i（Cat No.:I034335）is a potent peptide inhibitor designed to target PDZ domains, crucial for protein-protein interactions involved in cellular signaling. By inhibiting the PDZ1 domain, it effectively disrupts the binding of key proteins involved in processes such as cell migration, synaptic signaling, and neurodegenerative diseases. This inhibitor is of interest in both cancer and neurological disease research, offering potential therapeutic applications for conditions driven by dysregulated protein interactions. PDZ1i’s specificity and ability to modulate these pathways make it a promising tool in drug development targeting complex molecular mechanisms.
| CAS Number | 2083618-79-3 |
| Synonyms | N-[2,5-dimethyl-4-[3-(5-phenyl-1,3,4-oxadiazol-2-yl)propanoylamino]phenyl]-2-oxo-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-triene-11-carboxamide |
| Molecular Formula | C28H26N8O4 |
| Purity | ≥95% |
| IUPAC Name | N-[2,5-dimethyl-4-[3-(5-phenyl-1,3,4-oxadiazol-2-yl)propanoylamino]phenyl]-2-oxo-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-triene-11-carboxamide |
| InChI | InChI=1S/C28H26N8O4/c1-15-14-21(30-25(38)24-32-28-31-19-10-6-9-18(19)27(39)36(28)35-24)16(2)13-20(15)29-22(37)11-12-23-33-34-26(40-23)17-7-4-3-5-8-17/h3-5,7-8,13-14H,6,9-12H2,1-2H3,(H,29,37)(H,30,38)(H,31,32,35) |
| InChIKey | DWWDFNUIUZQWOP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1NC(=O)C2=NC3=NC4=C(CCC4)C(=O)N3N2)C)NC(=O)CCC5=NN=C(O5)C6=CC=CC=C6 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
