For research use only. Not for therapeutic Use.
PDE12-IN-1（Cat No.:I015554）is a potent and selective small-molecule inhibitor of phosphodiesterase 12 (PDE12), an enzyme involved in regulating mitochondrial RNA processing and innate immune responses. By inhibiting PDE12, this compound stabilizes 2′,5′-oligoadenylates, enhancing RNase L activity and strengthening antiviral defense mechanisms. PDE12-IN-1 has been studied as a tool for exploring mitochondrial function, immune modulation, and host–virus interactions. Its activity makes it particularly useful in antiviral research, providing insights into therapeutic strategies against RNA viruses while also serving as a probe for mitochondrial RNA metabolism.
| CAS Number | 2259620-80-7 |
| Synonyms | 3-[5-bromo-6-[(2R,3R)-2-(4-fluorophenyl)-3-(hydroxymethyl)morpholine-4-carbonyl]-1-methylbenzimidazol-2-yl]-1-ethylindole-6-carbonitrile |
| Molecular Formula | C31H27BrFN5O3 |
| Purity | ≥95% |
| IUPAC Name | 3-[5-bromo-6-[(2R,3R)-2-(4-fluorophenyl)-3-(hydroxymethyl)morpholine-4-carbonyl]-1-methylbenzimidazol-2-yl]-1-ethylindole-6-carbonitrile |
| InChI | InChI=1S/C31H27BrFN5O3/c1-3-37-16-23(21-9-4-18(15-34)12-26(21)37)30-35-25-14-24(32)22(13-27(25)36(30)2)31(40)38-10-11-41-29(28(38)17-39)19-5-7-20(33)8-6-19/h4-9,12-14,16,28-29,39H,3,10-11,17H2,1-2H3/t28-,29-/m1/s1 |
| InChIKey | YWMAQKQMUXYMAZ-FQLXRVMXSA-N |
| SMILES | CCN1C=C(C2=C1C=C(C=C2)C#N)C3=NC4=C(N3C)C=C(C(=C4)Br)C(=O)N5CCO[C@@H]([C@H]5CO)C6=CC=C(C=C6)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
