For research use only. Not for therapeutic Use.
PD318088(Cat No.:I003434) is a small molecule inhibitor specifically designed to target the MEK1/2 (Mitogen-Activated Protein Kinase Kinase 1/2) enzymes, which are pivotal in the MAPK/ERK signaling pathway. This pathway is crucial for cell division, differentiation, and survival, and its dysregulation is commonly associated with various cancers. PD318088 works by binding to MEK1/2, inhibiting their activity and thus blocking the downstream signaling that leads to cancer cell growth and proliferation. This mechanism of action makes PD318088 a potential therapeutic agent for treating cancers that exhibit abnormal MAPK/ERK pathway activity.
CAS Number | 391210-00-7 |
Synonyms | 5-bromo-N-(2,3-dihydroxypropoxy)-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide |
Molecular Formula | C₁₆H₁₃BrF₃IN₂O₄ |
Purity | ≥95% |
Target | MEK |
Solubility | DMSO ≥110mg/mL Water <1.2mg/mL Ethanol ≥12mg/mL |
Storage | 3 years -20C powder |
IUPAC Name | 5-bromo-N-(2,3-dihydroxypropoxy)-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide |
InChI | InChI=1S/C16H13BrF3IN2O4/c17-10-4-9(16(26)23-27-6-8(25)5-24)15(14(20)13(10)19)22-12-2-1-7(21)3-11(12)18/h1-4,8,22,24-25H,5-6H2,(H,23,26) |
InChIKey | XXSSGBYXSKOLAM-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1I)F)NC2=C(C(=C(C=C2C(=O)NOCC(CO)O)Br)F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |