For research use only. Not for therapeutic Use.
PCNA-I1（Cat No.:I011191）is a selective peptide inhibitor targeting Proliferating Cell Nuclear Antigen (PCNA), a crucial protein in DNA replication and repair. By inhibiting PCNA, PCNA-I1 disrupts the interaction between PCNA and its partners, interfering with DNA replication and cell cycle progression. This inhibition is particularly valuable in cancer research, where uncontrolled cell division is a hallmark. PCNA-I1 offers potential therapeutic applications for targeting tumor cell proliferation and enhancing the effectiveness of cancer treatments. Its specificity for PCNA makes it a promising candidate for further investigation in cancer therapeutics.
| CAS Number | 444930-42-1 |
| Synonyms | N-[(E)-(1-hydroxynaphthalen-2-yl)methylideneamino]-3-methylthiophene-2-carboxamide |
| Molecular Formula | C17H14N2O2S |
| Purity | ≥95% |
| IUPAC Name | N-[(E)-(1-hydroxynaphthalen-2-yl)methylideneamino]-3-methylthiophene-2-carboxamide |
| InChI | InChI=1S/C17H14N2O2S/c1-11-8-9-22-16(11)17(21)19-18-10-13-7-6-12-4-2-3-5-14(12)15(13)20/h2-10,20H,1H3,(H,19,21)/b18-10+ |
| InChIKey | NZWTWRNHYZNWNW-VCHYOVAHSA-N |
| SMILES | CC1=C(SC=C1)C(=O)N/N=C/C2=C(C3=CC=CC=C3C=C2)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
