For research use only. Not for therapeutic Use.
PC Mal-NHS carbonate ester（Cat No.:I016106）is a heterobifunctional crosslinker engineered for efficient bioconjugation and drug development. It features a maleimide (Mal) group that selectively reacts with thiol groups, and an NHS carbonate ester that couples effectively with primary amines, enabling stable and site-specific linkage. The carbonate ester chemistry provides enhanced hydrolytic stability compared to conventional NHS esters, ensuring reliable performance during synthesis. This reagent is particularly valuable in preparing antibody–drug conjugates, protein modifications, and polymer–biomolecule conjugates, supporting applications in chemical biology, targeted delivery, and therapeutic research.
| CAS Number | 1408057-91-9 |
| Synonyms | (2,5-dioxopyrrolidin-1-yl) 1-[4-[4-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-4-oxobutoxy]-5-methoxy-2-nitrophenyl]ethyl carbonate |
| Molecular Formula | C24H26N4O12 |
| Purity | ≥95% |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 1-[4-[4-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-4-oxobutoxy]-5-methoxy-2-nitrophenyl]ethyl carbonate |
| InChI | InChI=1S/C24H26N4O12/c1-14(39-24(34)40-27-22(32)7-8-23(27)33)15-12-17(37-2)18(13-16(15)28(35)36)38-11-3-4-19(29)25-9-10-26-20(30)5-6-21(26)31/h5-6,12-14H,3-4,7-11H2,1-2H3,(H,25,29) |
| InChIKey | YDJBJIRRIMMTEU-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=C(C=C1[N+](=O)[O-])OCCCC(=O)NCCN2C(=O)C=CC2=O)OC)OC(=O)ON3C(=O)CCC3=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
