For research use only. Not for therapeutic Use.
PARG-IN-4(CAT: I040530) is a selective inhibitor of Poly(ADP-ribose) glycohydrolase (PARG), a key enzyme responsible for hydrolyzing poly(ADP-ribose) chains in the DNA damage response pathway. By blocking PARG activity, PARG-IN-4 enhances DNA damage persistence and impairs cellular repair mechanisms, leading to increased sensitivity to genotoxic stress—especially in cancer cells. This compound is valuable for exploring synthetic lethality strategies and for understanding the therapeutic potential of PARG inhibition in oncology. PARG-IN-4 is suitable for mechanistic studies, target validation, and combination therapy development alongside PARP inhibitors. Supplied in high purity, it is intended for use in advanced biochemical and cancer research applications.
| CAS Number | 2988890-20-4 |
| Synonyms | 1-[5-(difluoromethyl)-1,3,4-thiadiazol-2-yl]-4-[(3S,5S)-3,5-dimethylpiperazin-1-yl]-N-(1-methylcyclopropyl)indazole-6-sulfonamide |
| Molecular Formula | C20H25F2N7O2S2 |
| Purity | ≥95% |
| IUPAC Name | 1-[5-(difluoromethyl)-1,3,4-thiadiazol-2-yl]-4-[(3S,5S)-3,5-dimethylpiperazin-1-yl]-N-(1-methylcyclopropyl)indazole-6-sulfonamide |
| InChI | InChI=1S/C20H25F2N7O2S2/c1-11-9-28(10-12(2)24-11)15-6-13(33(30,31)27-20(3)4-5-20)7-16-14(15)8-23-29(16)19-26-25-18(32-19)17(21)22/h6-8,11-12,17,24,27H,4-5,9-10H2,1-3H3/t11-,12-/m0/s1 |
| InChIKey | AQOUTSJIZZVANZ-RYUDHWBXSA-N |
| SMILES | CC1CN(CC(N1)C)C2=CC(=CC3=C2C=NN3C4=NN=C(S4)C(F)F)S(=O)(=O)NC5(CC5)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
