For research use only. Not for therapeutic Use.
Paraldehyde(Cat No.:M070540) is a colorless liquid used as a sedative and anticonvulsant medication. Its history traces back to the 19th century, initially employed as a hypnotic agent. It acts on the central nervous system, depressing its activity and inducing relaxation. Though its use has declined due to safer alternatives, it remains occasionally utilized, particularly in managing alcohol withdrawal symptoms or in palliative care settings. Paraldehyde’s potency demands cautious administration due to its potential for respiratory depression and other adverse effects. Its mechanism enhances the inhibitory neurotransmitter gamma-aminobutyric acid (GABA) in the brain.
| CAS Number | 123-63-7 |
| Molecular Formula | C6H12O3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2,4,6-trimethyl-1,3,5-trioxane |
| InChI | InChI=1S/C6H12O3/c1-4-7-5(2)9-6(3)8-4/h4-6H,1-3H3 |
| InChIKey | SQYNKIJPMDEDEG-UHFFFAOYSA-N |
| SMILES | CC1OC(OC(O1)C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |