For research use only. Not for therapeutic Use.
Pantoprazole sodium is a proton pump inhibitor (PPI) used to reduce stomach acid production. It works by inhibiting the H+/K+ ATPase enzyme in the stomach lining, effectively blocking the final step of acid secretion. Pantoprazole is commonly prescribed for conditions like gastroesophageal reflux disease (GERD), peptic ulcers, and gastritis. It helps alleviate symptoms like heartburn and allows for healing of damaged tissue. Pantoprazole is typically well-tolerated but may have side effects such as headache, nausea, and abdominal discomfort with long-term use.
| CAS Number | 138786-67-1 |
| Synonyms | KF96022 sodium, BY-1023 sodium |
| Molecular Formula | C16H14F2N3NaO4S |
| Purity | ≥95% |
| Target | Autophagy |
| Storage | Store at -20°C |
| IUPAC Name | sodium;5-(difluoromethoxy)-2-[(3,4-dimethoxypyridin-2-yl)methylsulfinyl]benzimidazol-1-ide |
| InChI | 1S/C16H14F2N3O4S.Na/c1-23-13-5-6-19-12(14(13)24-2)8-26(22)16-20-10-4-3-9(25-15(17)18)7-11(10)21-16;/h3-7,15H,8H2,1-2H3;/q-1;+1 |
| InChIKey | YNWDKZIIWCEDEE-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=NC=C1)CS(=O)C2=NC3=C([N-]2)C=CC(=C3)OC(F)F)OC.[Na+] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |