For research use only. Not for therapeutic Use.
Pangelin（Cat No.:I044835）is a naturally occurring dihydrochalcone compound found in certain plant species, notably within the Dioscorea and Populus genera. Structurally, it features a flavonoid backbone with hydroxyl and methoxy substitutions, contributing to its antioxidant and anti-inflammatory properties. Pangelin has shown potential in scavenging free radicals and modulating pro-inflammatory mediators, making it relevant in studies of oxidative stress-related conditions. Though less extensively studied than other flavonoids, it is gaining interest for its potential applications in nutraceuticals and functional foods aimed at supporting cardiovascular and metabolic health through natural plant-based therapies.
| CAS Number | 33783-80-1 |
| Synonyms | 4-[(2R)-2-hydroxy-3-methylbut-3-enoxy]furo[3,2-g]chromen-7-one |
| Molecular Formula | C16H14O5 |
| Purity | ≥95% |
| IUPAC Name | 4-[(2R)-2-hydroxy-3-methylbut-3-enoxy]furo[3,2-g]chromen-7-one |
| InChI | InChI=1S/C16H14O5/c1-9(2)12(17)8-20-16-10-3-4-15(18)21-14(10)7-13-11(16)5-6-19-13/h3-7,12,17H,1,8H2,2H3/t12-/m0/s1 |
| InChIKey | BVMOMQJYQYBMKL-LBPRGKRZSA-N |
| SMILES | CC(=C)[C@H](COC1=C2C=CC(=O)OC2=CC3=C1C=CO3)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
