For research use only. Not for therapeutic Use.
Palmaturbine(CAT:M083153) is an isoquinoline alkaloid belonging to the protoberberine group, closely related to compounds such as berberine and jatrorrhizine. It is typically found in plants of the Berberidaceae and Menispermaceae families, including Berberis species. Structurally, palmaturbine features a tetracyclic protoberberine backbone with methoxy substitutions, which contribute to its biological activity. Research has shown that palmaturbine may possess antimicrobial, anti-inflammatory, and cytotoxic properties, and like other protoberberine alkaloids, it can interact with nucleic acids and enzymes, influencing cellular metabolism. It is mainly studied in phytochemistry, natural product pharmacology, and as a potential lead compound for drug discovery.
| CAS Number | 16176-68-4 |
| Synonyms | 2,3,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-9-ol |
| Molecular Formula | C20H20NO4 |
| Purity | ≥95% |
| IUPAC Name | 2,3,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-9-ol |
| InChI | InChI=1S/C20H19NO4/c1-23-17-5-4-12-8-16-14-10-19(25-3)18(24-2)9-13(14)6-7-21(16)11-15(12)20(17)22/h4-5,8-11H,6-7H2,1-3H3/p+1 |
| InChIKey | QBUIDYLGKMWNEA-UHFFFAOYSA-O |
| SMILES | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC(=C(C=C4CC3)OC)OC)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
