For research use only. Not for therapeutic Use.
P7C3-OMe（Cat No.:I046074）is a neuroprotective small-molecule derivative of the P7C3 series, known for enhancing neuronal survival and promoting neurogenesis. It functions by stabilizing nicotinamide phosphoribosyltransferase (NAMPT) activity, thereby boosting NAD⁺ biosynthesis and supporting cellular energy homeostasis. P7C3-OMe has demonstrated protective effects in models of neurodegeneration, traumatic brain injury, and aging-related cognitive decline. Its improved potency and pharmacokinetics compared to earlier analogs make it a valuable research tool. P7C3-OMe is widely studied for its potential in developing therapies for Alzheimer’s disease, Parkinson’s disease, and other neurodegenerative disorders.
| CAS Number | 313268-18-7 |
| Synonyms | 1-(3,6-dibromocarbazol-9-yl)-3-(3-methoxyanilino)propan-2-ol |
| Molecular Formula | C22H20Br2N2O2 |
| Purity | ≥95% |
| IUPAC Name | 1-(3,6-dibromocarbazol-9-yl)-3-(3-methoxyanilino)propan-2-ol |
| InChI | InChI=1S/C22H20Br2N2O2/c1-28-18-4-2-3-16(11-18)25-12-17(27)13-26-21-7-5-14(23)9-19(21)20-10-15(24)6-8-22(20)26/h2-11,17,25,27H,12-13H2,1H3 |
| InChIKey | LEICNUMXFWNCSJ-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)NCC(CN2C3=C(C=C(C=C3)Br)C4=C2C=CC(=C4)Br)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
