For research use only. Not for therapeutic Use.
p-Tyramine (Cat No.:R007157) is a naturally occurring monoamine compound derived from the amino acid tyrosine. It has the chemical formula C8H11NO and features a phenethylamine backbone with a hydroxyl group at the para position of the benzene ring. Found in various fermented foods like cheese and cured meats, p-tyramine acts as a trace amine in the human body, influencing neurotransmitter systems. It can stimulate the release of norepinephrine, leading to increased blood pressure and alertness. p-Tyramine is studied for its role in mood regulation, migraines, and as a biomarker in neurological research.
| CAS Number | 51-67-2 |
| Synonyms | 4-(2-Aminoethyl)phenol Hydrochloride; 2-(4-Hydroxyphenyl)ethylamine; 2-(4’-Hydroxyphenyl)ethylamine; 2-(p-Hydroxyphenyl)ethylamine; 4-(2-Aminoethyl)phenol; 4-Hydroxy-β-phenylethylamine; 4-Hydroxyphenethylamine; 4-Hydroxyphenylethylamine; 4-Hydroxyben |
| Molecular Formula | C8H11NO |
| Purity | ≥95% |
| Target | Endogenous Metabolite |
| Storage | -20°C |
| IUPAC Name | 4-(2-aminoethyl)phenol |
| InChI | InChI=1S/C8H11NO/c9-6-5-7-1-3-8(10)4-2-7/h1-4,10H,5-6,9H2 |
| InChIKey | DZGWFCGJZKJUFP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCN)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
