For research use only. Not for therapeutic Use.
P-Tolyl Acetate (Cat.No:M067405) is an organic compound used in perfumery and fragrance industries. It possesses a sweet, floral, and slightly fruity scent, making it a valuable ingredient in various personal care products and perfumes. Additionally, it finds applications in chemical synthesis for the production of specialized compounds.
| CAS Number | 140-39-6 |
| Molecular Formula | C9H10O2 |
| Purity | ≥95% |
| Storage | Store at RT |
| IUPAC Name | (4-methylphenyl) acetate |
| InChI | InChI=1S/C9H10O2/c1-7-3-5-9(6-4-7)11-8(2)10/h3-6H,1-2H3 |
| InChIKey | CDJJKTLOZJAGIZ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)OC(=O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
