For research use only. Not for therapeutic Use.
p-Chlorophenyl methyl sulfone (Cat.No:R070349) is a chemical compound used in organic synthesis and as a reagent in the preparation of various products. Its structure features a phenyl ring with a chlorine atom and a methyl sulfone group attached. It serves as a versatile building block in the creation of diverse molecules.
CAS Number | 98-57-7 |
Synonyms | Methyl-4-chlorophenyl sulfone |
Molecular Formula | C7H7ClO2S |
Purity | ≥95% |
Storage | RT |
IUPAC Name | 1-chloro-4-methylsulfonylbenzene |
InChI | InChI=1S/C7H7ClO2S/c1-11(9,10)7-4-2-6(8)3-5-7/h2-5H,1H3 |
InChIKey | LMCOQDVJBWVNNI-UHFFFAOYSA-N |
SMILES | CS(=O)(=O)C1=CC=C(C=C1)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |