For research use only. Not for therapeutic Use.
p-(2-Cyclohexenyloxy)benzoic acid is a compound characterized by a benzoic acid core with a para-substituted cyclohexenyl group attached via an ether linkage. This compound exhibits interesting chemical and biological properties due to its unique structure. It may find applications in organic synthesis as a building block for the preparation of various derivatives. Additionally, its potential biological activities, such as anti-inflammatory or antimicrobial effects, could make it a subject of interest in pharmaceutical research for the development of new therapeutic agents.
CAS Number | 7355-51-3 |
Synonyms | 4-(2-Cyclohexenenyloxy)benzoic acid |
Molecular Formula | C13H14O3 |
Purity | ≥95% |
Storage | RT |
IUPAC Name | 4-cyclohex-2-en-1-yloxybenzoic acid |
InChI | InChI=1S/C13H14O3/c14-13(15)10-6-8-12(9-7-10)16-11-4-2-1-3-5-11/h2,4,6-9,11H,1,3,5H2,(H,14,15) |
InChIKey | PDVBRFKIRWATOO-UHFFFAOYSA-N |
SMILES | C1CC=CC(C1)OC2=CC=C(C=C2)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |