For research use only. Not for therapeutic Use.
(–)-Oxypeucedanin hydrate（Cat No.:R009207）is a furanocoumarin compound found in plants of the Apiaceae family, particularly in Peucedanum and Angelica species. It exhibits various pharmacological activities, including anticancer, anti-inflammatory, antimicrobial, and photosensitizing effects. (–)-Oxypeucedanin hydrate can inhibit cancer cell proliferation and induce apoptosis, often through modulation of oxidative stress and signaling pathways like MAPK. It also shows potential in photodynamic therapy due to its ability to absorb UV light and generate reactive oxygen species. This compound is of interest for drug development in cancer, infection control, and dermatological applications involving photoactive agents.
| CAS Number | 133164-11-1 |
| Synonyms | 4-[(2S)-2,3-dihydroxy-3-methylbutoxy]furo[3,2-g]chromen-7-one |
| Molecular Formula | C16H16O6 |
| Purity | ≥95% |
| IUPAC Name | 4-[(2S)-2,3-dihydroxy-3-methylbutoxy]furo[3,2-g]chromen-7-one |
| InChI | InChI=1S/C16H16O6/c1-16(2,19)13(17)8-21-15-9-3-4-14(18)22-12(9)7-11-10(15)5-6-20-11/h3-7,13,17,19H,8H2,1-2H3/t13-/m0/s1 |
| InChIKey | PEWFWDOPJISUOK-ZDUSSCGKSA-N |
| SMILES | CC(C)([C@H](COC1=C2C=CC(=O)OC2=CC3=C1C=CO3)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
