For research use only. Not for therapeutic Use.
Oxypalmatine（Cat No.:M140761）is a naturally occurring protoberberine alkaloid, primarily isolated from plants such as Corydalis species and Stephania. Structurally related to tetrahydropalmatine, it possesses a distinctive oxygen substitution that influences its pharmacological profile. Oxypalmatine has been studied for analgesic, anti-inflammatory, sedative, and neuroprotective effects. Research indicates it may act on dopaminergic and other neurotransmitter systems, contributing to its potential in managing pain, anxiety, and neurological disorders. As a bioactive plant-derived compound, oxypalmatine is an important subject in natural product chemistry, pharmacology, and drug discovery for central nervous system therapeutics.
| CAS Number | 19716-59-7 |
| Synonyms | 2,3,9,10-tetramethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-8-one |
| Molecular Formula | C21H21NO5 |
| Purity | ≥95% |
| IUPAC Name | 2,3,9,10-tetramethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-8-one |
| InChI | InChI=1S/C21H21NO5/c1-24-16-6-5-13-9-15-14-11-18(26-3)17(25-2)10-12(14)7-8-22(15)21(23)19(13)20(16)27-4/h5-6,9-11H,7-8H2,1-4H3 |
| InChIKey | MZIUUCTTWZPXOV-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1)C=C3C4=CC(=C(C=C4CCN3C2=O)OC)OC)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
