For research use only. Not for therapeutic Use.
Oxyimperatorin(CAT: R072644) is a naturally occurring furanocoumarin derivative found in several medicinal plants, particularly those of the Apiaceae family. As a bioactive coumarin, it exhibits diverse pharmacological properties, including anti-inflammatory, antioxidant, and antimicrobial activities. Its structure, characterized by a coumarin backbone with oxygenated substituents, contributes to its ability to modulate cellular signaling pathways and protect against oxidative stress. Oxyimperatorin has attracted interest in natural product research, pharmacognosy, and drug discovery, especially in the context of inflammation, infection, and chronic disease models. It is a valuable chemical standard and probe for exploring the therapeutic potential of furanocoumarins.
| CAS Number | 35740-18-2 |
| Synonyms | 9-[(3,3-dimethyloxiran-2-yl)methoxy]furo[3,2-g]chromen-7-one |
| Molecular Formula | C16H14O5 |
| Purity | ≥95% |
| IUPAC Name | 9-[(3,3-dimethyloxiran-2-yl)methoxy]furo[3,2-g]chromen-7-one |
| InChI | InChI=1S/C16H14O5/c1-16(2)11(21-16)8-19-15-13-10(5-6-18-13)7-9-3-4-12(17)20-14(9)15/h3-7,11H,8H2,1-2H3 |
| InChIKey | CTJZWFCPUDPLME-UHFFFAOYSA-N |
| SMILES | CC1(C(O1)COC2=C3C(=CC4=C2OC=C4)C=CC(=O)O3)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
