Oxyclozanide（Cat No.:R035646）, also known as Oxiclozanidum, Zanil, Oxyclozanid, or Zanilox, is an N-salicylanilide compound with insect-repellent properties. It acts as both an insect repellent and a mitochondrial uncoupling agent. As an insect repellent, it is used to deter insects and parasites from infesting animals. Its ability to uncouple mitochondrial oxidative phosphorylation disrupts the production of adenosine triphosphate (ATP) in insects, leading to their death. This dual action makes Oxyclozanide a valuable tool in controlling insect infestations and protecting animals from pests.
| Catalog Number | R035646 |
| CAS Number | 2277-92-1 |
| Synonyms | 3,3’,5,5’,6-Pentachloro-2’-hydroxysalicylanilide;?2,3,5-Trichloro-N-(3,5-dichloro-2-hydroxyphenyl)-6-hydroxybenzamide;?3,3’,5,5’,6-Pentachloro-2,2’-dihydroxybenzanilide;?3,3’,5,5’,6-Pentachloro-2’-hydroxysalicylanilide;?3,5,6,3’,5’-Pentachloro-2,2’-d |
| Molecular Formula | C₁₃H₆Cl₅NO₃ |
| Purity | 95% |
| Storage | Store at RT |
| IUPAC Name | 2,3,5-trichloro-N-(3,5-dichloro-2-hydroxyphenyl)-6-hydroxybenzamide |
| InChI | InChI=1S/C13H6Cl5NO3/c14-4-1-6(16)11(20)8(2-4)19-13(22)9-10(18)5(15)3-7(17)12(9)21/h1-3,20-21H,(H,19,22) |
| InChIKey | JYWIYHUXVMAGLG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1NC(=O)C2=C(C(=CC(=C2Cl)Cl)Cl)O)O)Cl)Cl |
