For research use only. Not for therapeutic Use.
Oxpoconazole fumarate(Cat No.:M046318) is a chemical compound specifically used as a fungicide. It belongs to the class of conazole fungicides, which are known for their role in inhibiting the synthesis of ergosterol, an essential component of fungal cell membranes. The “fumarate” refers to its formulation as the fumaric acid salt, which can enhance its stability and solubility for agricultural applications. Oxpoconazole fumarate is particularly effective against a broad spectrum of fungal pathogens and is used to protect crops by preventing and treating fungal diseases that could otherwise devastate agricultural yields.
CAS Number | 174212-12-5 |
Molecular Formula | C42H52Cl2N6O8 |
Purity | ≥95% |
Storage | Desiccate at -20C |
IUPAC Name | (E)-but-2-enedioic acid;[2-[3-(4-chlorophenyl)propyl]-2,4,4-trimethyl-1,3-oxazolidin-3-yl]-imidazol-1-ylmethanone |
InChI | InChI=1S/2C19H24ClN3O2.C4H4O4/c2*1-18(2)13-25-19(3,23(18)17(24)22-12-11-21-14-22)10-4-5-15-6-8-16(20)9-7-15;5-3(6)1-2-4(7)8/h2*6-9,11-12,14H,4-5,10,13H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;;2-1+ |
InChIKey | IKNXXTIMVROREQ-WXXKFALUSA-N |
SMILES | CC1(COC(N1C(=O)N2C=CN=C2)(C)CCCC3=CC=C(C=C3)Cl)C.CC1(COC(N1C(=O)N2C=CN=C2)(C)CCCC3=CC=C(C=C3)Cl)C.C(=CC(=O)O)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |