For research use only. Not for therapeutic Use.
Oxolinic acid-d₅(Cat No.:R009466)is a deuterated form of oxolinic acid, a quinolone antibiotic, in which five hydrogen atoms are replaced with deuterium. This stable isotope-labeled compound is primarily used as an internal standard in mass spectrometry for accurate quantification of oxolinic acid in biological samples. Oxolinic acid itself inhibits bacterial DNA gyrase, disrupting DNA replication and transcription. The deuterated version retains identical chemical and pharmacological properties, ensuring analytical precision without biological interference. Oxolinic acid-d₅ is valuable in pharmacokinetic, residue analysis, and drug metabolism studies, particularly in veterinary and microbiological research.
CAS Number | 1189890-98-9 |
Synonyms | 8-oxo-5-(1,1,2,2,2-pentadeuterioethyl)-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid |
Molecular Formula | C13H6D5NO5 |
Purity | ≥95% |
IUPAC Name | 8-oxo-5-(1,1,2,2,2-pentadeuterioethyl)-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid |
InChI | InChI=1S/C13H11NO5/c1-2-14-5-8(13(16)17)12(15)7-3-10-11(4-9(7)14)19-6-18-10/h3-5H,2,6H2,1H3,(H,16,17)/i1D3,2D2 |
InChIKey | KYGZCKSPAKDVKC-ZBJDZAJPSA-N |
SMILES | [2H]C([2H])([2H])C([2H])([2H])N1C=C(C(=O)C2=CC3=C(C=C21)OCO3)C(=O)O |
Reference |
|
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |