For research use only. Not for therapeutic Use.
Oxidopamine hydrochloride (Cat.No:I002956) is a neurotoxin commonly used in research to induce Parkinson’s disease-like symptoms in animal models. It selectively destroys dopaminergic neurons, leading to dopamine depletion and motor impairments. Oxidopamine hydrochloride is valuable for studying the pathogenesis and potential therapeutic interventions for Parkinson’s disease in preclinical studies.
| CAS Number | 28094-15-7 |
| Molecular Formula | C8H12ClNO3 |
| Purity | ≥95% |
| Target | GPCR/G Protein |
| Storage | -20 ℃ |
| IUPAC Name | 5-(2-aminoethyl)benzene-1,2,4-triol;hydrochloride |
| InChI | 1S/C8H11NO3.ClH/c9-2-1-5-3-7(11)8(12)4-6(5)10;/h3-4,10-12H,1-2,9H2;1H |
| InChIKey | QLMRJHFAGVFUAC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1O)O)O)CCN.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |