For research use only. Not for therapeutic Use.
Oxazole-5-carboxylic acid (Cat No.: M030237 ) is a heterocyclic aromatic compound consisting of a five-membered oxazole ring with a carboxylic acid group at the 5-position. The molecule exhibits both electrophilic and nucleophilic reactivity, making it a versatile intermediate in organic synthesis. Its heteroaromatic structure is valuable in medicinal chemistry for the design of bioactive molecules, including antimicrobial, anti-inflammatory, and anticancer agents. Additionally, oxazole-5-carboxylic acid serves as a precursor for peptidomimetics, ligands, and functionalized heterocycles in pharmaceutical and material science research.
CAS Number | 118994-90-4 |
Molecular Formula | C4H3NO3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1,3-oxazole-5-carboxylic acid |
InChI | InChI=1S/C4H3NO3/c6-4(7)3-1-5-2-8-3/h1-2H,(H,6,7) |
InChIKey | QCGMEWVZBGQOFN-UHFFFAOYSA-N |
SMILES | C1=C(OC=N1)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |