For research use only. Not for therapeutic Use.
Oxazine 170 perchlorate(Cat No.:I043050)is a synthetic organic compound that belongs to the oxazine class, characterized by a six-membered heterocyclic ring containing both oxygen and nitrogen atoms. It is often used as a fluorescent dye in various scientific and analytical applications, such as microscopy and flow cytometry, due to its distinct optical properties. The perchlorate salt form enhances the stability and solubility of the compound in solution. Oxazine 170 perchlorate has been employed in studies involving cellular imaging, biological research, and other fields that require sensitive fluorescent detection.
| CAS Number | 62669-60-7 |
| Synonyms | ethyl-[5-(ethylamino)-10-methylbenzo[a]phenoxazin-9-ylidene]azanium;perchlorate |
| Molecular Formula | C21H22ClN3O5 |
| Purity | ≥95% |
| IUPAC Name | ethyl-[5-(ethylamino)-10-methylbenzo[a]phenoxazin-9-ylidene]azanium;perchlorate |
| InChI | InChI=1S/C21H21N3O.ClHO4/c1-4-22-16-11-19-18(10-13(16)3)24-21-15-9-7-6-8-14(15)17(23-5-2)12-20(21)25-19;2-1(3,4)5/h6-12,23H,4-5H2,1-3H3;(H,2,3,4,5) |
| InChIKey | CBXAZZAYBZVPEZ-UHFFFAOYSA-N |
| SMILES | CCNC1=CC2=C(C3=CC=CC=C31)N=C4C=C(C(=[NH+]CC)C=C4O2)C.[O-]Cl(=O)(=O)=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |