For research use only. Not for therapeutic Use.
Oxazine 1 perchlorate(Cat No.:I013072)is a chemical compound used primarily in the field of organic chemistry and materials science. It is a heterocyclic compound featuring an oxygen and nitrogen-containing ring structure, with its perchlorate salt form being commonly employed in various chemical reactions. Oxazine 1 perchlorate has been investigated for its applications in organic synthesis and as a potential intermediate in the development of more complex compounds. Its unique molecular structure may offer specific reactivity in photochemistry or electrochemical studies. However, research on its biological and pharmacological properties is still limited.
CAS Number | 24796-94-9 |
Molecular Formula | C₂₀H₂₆ClN₃O₅ |
Purity | ≥95% |
Target | Dye Reagents |
Solubility | DMSO |
IUPAC Name | [7-(diethylamino)phenoxazin-3-ylidene]-diethylazanium;perchlorate |
InChI | InChI=1S/C20H26N3O.ClHO4/c1-5-22(6-2)15-9-11-17-19(13-15)24-20-14-16(23(7-3)8-4)10-12-18(20)21-17;2-1(3,4)5/h9-14H,5-8H2,1-4H3;(H,2,3,4,5)/q+1;/p-1 |
InChIKey | PKZWDLHLOBYXKV-UHFFFAOYSA-M |
SMILES | CCN(CC)C1=CC2=C(C=C1)N=C3C=CC(=[N+](CC)CC)C=C3O2.[O-]Cl(=O)(=O)=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |