For research use only. Not for therapeutic Use.
Osthenol（Cat No.:I044950）is a naturally occurring coumarin derivative found in various plants, particularly within the Apiaceae family. It exhibits notable pharmacological activities, including anti-inflammatory, antioxidant, antimicrobial, and anticancer effects. Osthenol has been shown to inhibit the production of pro-inflammatory mediators and scavenge reactive oxygen species, contributing to its protective effects in oxidative stress-related conditions. Additionally, it demonstrates cytotoxicity against certain cancer cell lines and inhibits microbial growth. With its benzopyrone structure, osthenol holds promise as a bioactive lead compound for the development of therapeutics targeting inflammation, infection, and cancer.
| CAS Number | 484-14-0 |
| Synonyms | 7-hydroxy-8-(3-methylbut-2-enyl)chromen-2-one |
| Molecular Formula | C14H14O3 |
| Purity | ≥95% |
| IUPAC Name | 7-hydroxy-8-(3-methylbut-2-enyl)chromen-2-one |
| InChI | InChI=1S/C14H14O3/c1-9(2)3-6-11-12(15)7-4-10-5-8-13(16)17-14(10)11/h3-5,7-8,15H,6H2,1-2H3 |
| InChIKey | RAKJVIPCCGXHHS-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C(C=CC2=C1OC(=O)C=C2)O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
