For research use only. Not for therapeutic Use.
Osmanthuside B(CAT: I040425) is a naturally occurring phenylethanoid glycoside isolated from Pseuderanthemum carruthersii (Seem.) Guill. var. atropurpureum (Bull.) Fosb. This compound exhibits a complex structure composed of aromatic and sugar moieties, contributing to its antioxidant and mild bioactive properties. Notably, Osmanthuside B demonstrates weak inhibitory activity against acetylcholinesterase (AChE), suggesting potential relevance in neuroprotective and cognitive function research. While its AChE inhibition is modest, it may support synergistic effects when studied in combination with other bioactive compounds. Osmanthuside B is of interest for phytochemical analysis, natural product screening, and early-stage research into plant-derived agents targeting neurodegenerative conditions.
| CAS Number | 94492-23-6 |
| Synonyms | [(2R,3R,4R,5R,6R)-5-hydroxy-2-(hydroxymethyl)-6-[2-(4-hydroxyphenyl)ethoxy]-4-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-3-yl] (E)-3-(4-hydroxyphenyl)prop-2-enoate |
| Molecular Formula | C29H36O13 |
| Purity | ≥95% |
| IUPAC Name | [(2R,3R,4R,5R,6R)-5-hydroxy-2-(hydroxymethyl)-6-[2-(4-hydroxyphenyl)ethoxy]-4-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-3-yl] (E)-3-(4-hydroxyphenyl)prop-2-enoate |
| InChI | InChI=1S/C29H36O13/c1-15-22(34)23(35)24(36)29(39-15)42-27-25(37)28(38-13-12-17-4-9-19(32)10-5-17)40-20(14-30)26(27)41-21(33)11-6-16-2-7-18(31)8-3-16/h2-11,15,20,22-32,34-37H,12-14H2,1H3/b11-6+/t15-,20+,22-,23+,24+,25+,26+,27+,28+,29-/m0/s1 |
| InChIKey | PRTREKIVGSNQRM-DQHNYDBYSA-N |
| SMILES | CC1C(C(C(C(O1)OC2C(C(OC(C2OC(=O)C=CC3=CC=C(C=C3)O)CO)OCCC4=CC=C(C=C4)O)O)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
