For research use only. Not for therapeutic Use.
Osilodrostat phosphate（Cat No.:I033988）is a medication used to treat Cushing’s disease, a condition caused by excessive cortisol production. It is an inhibitor of the enzyme 11β-hydroxylase (CYP11B1), which plays a key role in the synthesis of cortisol in the adrenal glands. By inhibiting this enzyme, osilodrostat reduces cortisol production, helping to manage symptoms associated with hypercortisolism, such as weight gain, high blood pressure, and osteoporosis. Osilodrostat phosphate is typically prescribed when surgery is not an option or has been unsuccessful in controlling the disease.
| CAS Number | 1315449-72-9 |
| Synonyms | 4-[(5R)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-5-yl]-3-fluorobenzonitrile;phosphoric acid |
| Molecular Formula | C13H13FN3O4P |
| Purity | ≥95% |
| IUPAC Name | 4-[(5R)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-5-yl]-3-fluorobenzonitrile;phosphoric acid |
| InChI | InChI=1S/C13H10FN3.H3O4P/c14-12-5-9(6-15)1-3-11(12)13-4-2-10-7-16-8-17(10)13;1-5(2,3)4/h1,3,5,7-8,13H,2,4H2;(H3,1,2,3,4)/t13-;/m1./s1 |
| InChIKey | FMCPYRDGUZBOJZ-BTQNPOSSSA-N |
| SMILES | C1CC2=CN=CN2[C@H]1C3=C(C=C(C=C3)C#N)F.OP(=O)(O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
