For research use only. Not for therapeutic Use.
Oseltamivir(CAT: R030042) is an oral antiviral drug widely used for the treatment and prevention of influenza A and B infections. It acts as a neuraminidase inhibitor, blocking the viral enzyme responsible for the release of new virus particles from infected cells, thereby reducing the spread of the virus in the respiratory tract. Oseltamivir is typically administered as oseltamivir phosphate, a prodrug that is rapidly converted in the liver to its active form, oseltamivir carboxylate. It is most effective when taken within 48 hours of symptom onset.
| CAS Number | 196618-13-0 |
| Synonyms | (-)-Oseltamivir; Enfluvir; Ethyl (3R,4R,5S)-5-amino-4-acetamido-3-(pentan-3-yloxy)cyclohex-1-ene-1-carboxylate; GOP-A-Flu; GS 4104; Oseltamivir; Tamiflu-Free;Tamvir |
| Molecular Formula | C16H28N2O4 |
| Purity | ≥95% |
| Target | NA |
| Solubility | >15.6mg/mL in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | ethyl (3R,4R,5S)-4-acetamido-5-amino-3-pentan-3-yloxycyclohexene-1-carboxylate |
| InChI | InChI=1S/C16H28N2O4/c1-5-12(6-2)22-14-9-11(16(20)21-7-3)8-13(17)15(14)18-10(4)19/h9,12-15H,5-8,17H2,1-4H3,(H,18,19)/t13-,14+,15+/m0/s1 |
| InChIKey | VSZGPKBBMSAYNT-RRFJBIMHSA-N |
| SMILES | CCC(CC)O[C@@H]1C=C(C[C@@H]([C@H]1NC(=O)C)N)C(=O)OCC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
