For research use only. Not for therapeutic Use.
Oseltamivir Acid Hydrochloride(CAT: R045325) is the active metabolite of oseltamivir phosphate, a neuraminidase inhibitor widely used as an antiviral agent against influenza A and B viruses. This compound exerts its effects by blocking the viral neuraminidase enzyme, thereby preventing viral release and replication in host cells. Oseltamivir acid hydrochloride is commonly used in virology and pharmacology research to study influenza virus life cycle, resistance mechanisms, and antiviral drug efficacy. Its hydrochloride salt form enhances solubility and stability for experimental applications.
| CAS Number | 1415963-60-8 |
| Synonyms | (3R,4R,5S)-4-acetamido-5-amino-3-pentan-3-yloxycyclohexene-1-carboxylic acid;hydrochloride |
| Molecular Formula | C14H25ClN2O4 |
| Purity | ≥95% |
| IUPAC Name | (3R,4R,5R)-4-acetamido-5-amino-3-pentan-3-yloxycyclohexene-1-carboxylic acid;hydrochloride |
| InChI | InChI=1S/C14H24N2O4.ClH/c1-4-10(5-2)20-12-7-9(14(18)19)6-11(15)13(12)16-8(3)17;/h7,10-13H,4-6,15H2,1-3H3,(H,16,17)(H,18,19);1H/t11-,12+,13+;/m0./s1 |
| InChIKey | OTBMMOBYSNFNOE-LUHWTZLKSA-N |
| SMILES | CCC(CC)OC1C=C(CC(C1NC(=O)C)N)C(=O)O.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
