For research use only. Not for therapeutic Use.
Oseltamivir acetate（Cat No.:I045041）is the prodrug form of oseltamivir, an orally administered antiviral medication used to treat and prevent influenza A and B infections. After absorption, it is converted in the liver to its active form, oseltamivir carboxylate, which inhibits the influenza virus neuraminidase enzyme. This inhibition blocks the release of new viral particles from infected cells, limiting viral spread within the respiratory tract. Oseltamivir acetate is most effective when administered within 48 hours of symptom onset and is widely used in seasonal flu management and pandemic preparedness due to its efficacy and safety profile.
| CAS Number | 1191921-01-3 |
| Synonyms | ethyl (3R,4R,5S)-4,5-diacetamido-3-pentan-3-yloxycyclohexene-1-carboxylate |
| Molecular Formula | C18H30N2O5 |
| Purity | ≥95% |
| IUPAC Name | ethyl (3R,4R,5S)-4,5-diacetamido-3-pentan-3-yloxycyclohexene-1-carboxylate |
| InChI | InChI=1S/C18H30N2O5/c1-6-14(7-2)25-16-10-13(18(23)24-8-3)9-15(19-11(4)21)17(16)20-12(5)22/h10,14-17H,6-9H2,1-5H3,(H,19,21)(H,20,22)/t15-,16+,17+/m0/s1 |
| InChIKey | IWASCEKXRLUKKH-GVDBMIGSSA-N |
| SMILES | CCC(CC)O[C@@H]1C=C(C[C@@H]([C@H]1NC(=O)C)NC(=O)C)C(=O)OCC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
