For research use only. Not for therapeutic Use.
OS-3-106（Cat No.:I012318）is a selective small molecule inhibitor that targets specific proteins or signaling pathways involved in cancer cell proliferation and survival. It is primarily investigated for its potential to modulate key molecular targets within the tumor microenvironment, thereby inhibiting tumor growth and metastasis. OS-3-106 is used in preclinical research to study its effectiveness in treating various cancers and its ability to synergize with other therapeutic agents. By disrupting critical pathways, it holds promise as a potential candidate for developing targeted cancer therapies and improving patient outcomes.
| CAS Number | 1580000-17-4 |
| Synonyms | N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-4-(1,3-thiazol-4-yl)benzamide |
| Molecular Formula | C25H30N4O2S |
| Purity | ≥95% |
| IUPAC Name | N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-4-(1,3-thiazol-4-yl)benzamide |
| InChI | InChI=1S/C25H30N4O2S/c1-31-24-7-3-2-6-23(24)29-16-14-28(15-17-29)13-5-4-12-26-25(30)21-10-8-20(9-11-21)22-18-32-19-27-22/h2-3,6-11,18-19H,4-5,12-17H2,1H3,(H,26,30) |
| InChIKey | RGWFVVKSJUSKTE-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1N2CCN(CC2)CCCCNC(=O)C3=CC=C(C=C3)C4=CSC=N4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
